C23H23ClN2O4S2 — CID 112803797
N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-3-(phenylsulfanylmethyl)furan-2-carboxamide (PubChem CID 112803797) has the molecular formula C23H23ClN2O4S2 and a molecular weight of 491.03 g/mol. Its IUPAC name is N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-3-(phenylsulfanylmethyl)furan-2-carboxamide.
| Compound Name | N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-3-(phenylsulfanylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 112803797 |
| Molecular Formula | C23H23ClN2O4S2 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | N-(4-chloro-3-piperidin-1-ylsulfonylphenyl)-3-(phenylsulfanylmethyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1)c1occc1CSc1ccccc1 |
| InChI | InChI=1S/C23H23ClN2O4S2/c24-20-10-9-18(15-21(20)32(28,29)26-12-5-2-6-13-26)25-23(27)22-17(11-14-30-22)16-31-19-7-3-1-4-8-19/h1,3-4,7-11,14-15H,2,5-6,12-13,16H2,(H,25,27) |
| InChIKey | VUSPEFJRKGKUNM-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |