C24H23ClN2O4S2 — CID 28590683
2-chloro-5-morpholin-4-ylsulfonyl-N-[4-(phenylsulfanylmethyl)phenyl]benzamide (PubChem CID 28590683) has the molecular formula C24H23ClN2O4S2 and a molecular weight of 503.05 g/mol. Its IUPAC name is 2-chloro-5-morpholin-4-ylsulfonyl-N-[4-(phenylsulfanylmethyl)phenyl]benzamide.
| Compound Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-[4-(phenylsulfanylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 28590683 |
| Molecular Formula | C24H23ClN2O4S2 |
| Molecular Weight | 503.05 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-[4-(phenylsulfanylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CSc2ccccc2)cc1)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C24H23ClN2O4S2/c25-23-11-10-21(33(29,30)27-12-14-31-15-13-27)16-22(23)24(28)26-19-8-6-18(7-9-19)17-32-20-4-2-1-3-5-20/h1-11,16H,12-15,17H2,(H,26,28) |
| InChIKey | WZLDERFLNZOMLM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.05 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |