C22H20ClN3O4S — CID 55978562
2-chloro-5-morpholin-4-ylsulfonyl-N-(5-phenyl-2-pyridinyl)benzamide (PubChem CID 55978562) has the molecular formula C22H20ClN3O4S and a molecular weight of 457.94 g/mol. Its IUPAC name is 2-chloro-5-morpholin-4-ylsulfonyl-N-(5-phenyl-2-pyridinyl)benzamide.
| Compound Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-(5-phenyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 55978562 |
| Molecular Formula | C22H20ClN3O4S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-(5-phenyl-2-pyridinyl)benzamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cn1)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C22H20ClN3O4S/c23-20-8-7-18(31(28,29)26-10-12-30-13-11-26)14-19(20)22(27)25-21-9-6-17(15-24-21)16-4-2-1-3-5-16/h1-9,14-15H,10-13H2,(H,24,25,27) |
| InChIKey | XJLKUSHPRPTCNJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |