C13H18ClN3O4S — CID 9163691
2-chloro-N',N'-dimethyl-5-morpholin-4-ylsulfonylbenzohydrazide (PubChem CID 9163691) has the molecular formula C13H18ClN3O4S and a molecular weight of 347.82 g/mol. Its IUPAC name is 2-chloro-N',N'-dimethyl-5-morpholin-4-ylsulfonylbenzohydrazide.
| Compound Name | 2-chloro-N',N'-dimethyl-5-morpholin-4-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 9163691 |
| Molecular Formula | C13H18ClN3O4S |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 2-chloro-N',N'-dimethyl-5-morpholin-4-ylsulfonylbenzohydrazide |
| SMILES | CN(C)NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C13H18ClN3O4S/c1-16(2)15-13(18)11-9-10(3-4-12(11)14)22(19,20)17-5-7-21-8-6-17/h3-4,9H,5-8H2,1-2H3,(H,15,18) |
| InChIKey | MKOGYTGCIXOHBH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|