C17H24ClN3O4S — CID 50946940
2-chloro-N-(1-methylpiperidin-4-yl)-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 50946940) has the molecular formula C17H24ClN3O4S and a molecular weight of 401.92 g/mol. Its IUPAC name is 2-chloro-N-(1-methylpiperidin-4-yl)-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 2-chloro-N-(1-methylpiperidin-4-yl)-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 50946940 |
| Molecular Formula | C17H24ClN3O4S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-chloro-N-(1-methylpiperidin-4-yl)-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CN1CCC(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)CC1 |
| InChI | InChI=1S/C17H24ClN3O4S/c1-20-6-4-13(5-7-20)19-17(22)15-12-14(2-3-16(15)18)26(23,24)21-8-10-25-11-9-21/h2-3,12-13H,4-11H2,1H3,(H,19,22) |
| InChIKey | UUZBGGZLKZFHEX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |