C18H22ClF3N2O4S — CID 43046761
2-chloro-5-morpholin-4-ylsulfonyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide (PubChem CID 43046761) has the molecular formula C18H22ClF3N2O4S and a molecular weight of 454.90 g/mol. Its IUPAC name is 2-chloro-5-morpholin-4-ylsulfonyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide.
| Compound Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 43046761 |
| Molecular Formula | C18H22ClF3N2O4S |
| Molecular Weight | 454.90 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 2-chloro-5-morpholin-4-ylsulfonyl-N-[2-(trifluoromethyl)cyclohexyl]benzamide |
| SMILES | O=C(NC1CCCCC1C(F)(F)F)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C18H22ClF3N2O4S/c19-15-6-5-12(29(26,27)24-7-9-28-10-8-24)11-13(15)17(25)23-16-4-2-1-3-14(16)18(20,21)22/h5-6,11,14,16H,1-4,7-10H2,(H,23,25) |
| InChIKey | BUOAFBAQPNBTDB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.90 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |