C21H31BrN2O3S — CID 55593718
2-bromo-N-(2-tert-butylcyclohexyl)-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 55593718) has the molecular formula C21H31BrN2O3S and a molecular weight of 471.46 g/mol. Its IUPAC name is 2-bromo-N-(2-tert-butylcyclohexyl)-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-bromo-N-(2-tert-butylcyclohexyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55593718 |
| Molecular Formula | C21H31BrN2O3S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 2-bromo-N-(2-tert-butylcyclohexyl)-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CC(C)(C)C1CCCCC1NC(=O)c1cc(S(=O)(=O)N2CCCC2)ccc1Br |
| InChI | InChI=1S/C21H31BrN2O3S/c1-21(2,3)17-8-4-5-9-19(17)23-20(25)16-14-15(10-11-18(16)22)28(26,27)24-12-6-7-13-24/h10-11,14,17,19H,4-9,12-13H2,1-3H3,(H,23,25) |
| InChIKey | KDFVWKGSDVRPOT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |