C15H19BrN2O3S — CID 9442255
2-bromo-5-piperidin-1-ylsulfonyl-N-prop-2-enylbenzamide (PubChem CID 9442255) has the molecular formula C15H19BrN2O3S and a molecular weight of 387.30 g/mol. Its IUPAC name is 2-bromo-5-piperidin-1-ylsulfonyl-N-prop-2-enylbenzamide.
| Compound Name | 2-bromo-5-piperidin-1-ylsulfonyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 9442255 |
| Molecular Formula | C15H19BrN2O3S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2-bromo-5-piperidin-1-ylsulfonyl-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Br |
| InChI | InChI=1S/C15H19BrN2O3S/c1-2-8-17-15(19)13-11-12(6-7-14(13)16)22(20,21)18-9-4-3-5-10-18/h2,6-7,11H,1,3-5,8-10H2,(H,17,19) |
| InChIKey | BIQNPXNDLMFGFK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|