C21H26BrN3O3S — CID 26087024
2-bromo-N-[4-(diethylamino)phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 26087024) has the molecular formula C21H26BrN3O3S and a molecular weight of 480.43 g/mol. Its IUPAC name is 2-bromo-N-[4-(diethylamino)phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 2-bromo-N-[4-(diethylamino)phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 26087024 |
| Molecular Formula | C21H26BrN3O3S |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 2-bromo-N-[4-(diethylamino)phenyl]-5-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2cc(S(=O)(=O)N3CCCC3)ccc2Br)cc1 |
| InChI | InChI=1S/C21H26BrN3O3S/c1-3-24(4-2)17-9-7-16(8-10-17)23-21(26)19-15-18(11-12-20(19)22)29(27,28)25-13-5-6-14-25/h7-12,15H,3-6,13-14H2,1-2H3,(H,23,26) |
| InChIKey | RCOOHAZRYQHVMI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|