C20H21BrN2O6S — CID 26253160
ethyl 4-[(2-bromo-5-morpholin-4-ylsulfonylbenzoyl)amino]benzoate (PubChem CID 26253160) has the molecular formula C20H21BrN2O6S and a molecular weight of 497.37 g/mol. Its IUPAC name is ethyl 4-[(2-bromo-5-morpholin-4-ylsulfonylbenzoyl)amino]benzoate.
| Compound Name | ethyl 4-[(2-bromo-5-morpholin-4-ylsulfonylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 26253160 |
| Molecular Formula | C20H21BrN2O6S |
| Molecular Weight | 497.37 g/mol |
| Exact Mass | 496.03 |
| IUPAC Name | ethyl 4-[(2-bromo-5-morpholin-4-ylsulfonylbenzoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2Br)cc1 |
| InChI | InChI=1S/C20H21BrN2O6S/c1-2-29-20(25)14-3-5-15(6-4-14)22-19(24)17-13-16(7-8-18(17)21)30(26,27)23-9-11-28-12-10-23/h3-8,13H,2,9-12H2,1H3,(H,22,24) |
| InChIKey | JQUUOAPUMUOOAP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |