C19H20N2O6S — CID 43853441
N-(4-acetylphenyl)-2-hydroxy-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 43853441) has the molecular formula C19H20N2O6S and a molecular weight of 404.44 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-hydroxy-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(4-acetylphenyl)-2-hydroxy-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43853441 |
| Molecular Formula | C19H20N2O6S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-(4-acetylphenyl)-2-hydroxy-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | CC(=O)c1ccc(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2O)cc1 |
| InChI | InChI=1S/C19H20N2O6S/c1-13(22)14-2-4-15(5-3-14)20-19(24)17-12-16(6-7-18(17)23)28(25,26)21-8-10-27-11-9-21/h2-7,12,23H,8-11H2,1H3,(H,20,24) |
| InChIKey | NFKWOZQZARBEET-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |