C17H16Cl2N2O5S — CID 43853480
N-(2,4-dichlorophenyl)-2-hydroxy-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 43853480) has the molecular formula C17H16Cl2N2O5S and a molecular weight of 431.30 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-hydroxy-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-hydroxy-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43853480 |
| Molecular Formula | C17H16Cl2N2O5S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-hydroxy-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1cc(S(=O)(=O)N2CCOCC2)ccc1O |
| InChI | InChI=1S/C17H16Cl2N2O5S/c18-11-1-3-15(14(19)9-11)20-17(23)13-10-12(2-4-16(13)22)27(24,25)21-5-7-26-8-6-21/h1-4,9-10,22H,5-8H2,(H,20,23) |
| InChIKey | SBVLCNRNCGIQBV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |