C18H27ClN4O3S — CID 56699203
2-chloro-5-(4-methylpiperazin-1-yl)sulfonyl-N-(1-methylpiperidin-4-yl)benzamide (PubChem CID 56699203) has the molecular formula C18H27ClN4O3S and a molecular weight of 414.96 g/mol. Its IUPAC name is 2-chloro-5-(4-methylpiperazin-1-yl)sulfonyl-N-(1-methylpiperidin-4-yl)benzamide.
| Compound Name | 2-chloro-5-(4-methylpiperazin-1-yl)sulfonyl-N-(1-methylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 56699203 |
| Molecular Formula | C18H27ClN4O3S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-chloro-5-(4-methylpiperazin-1-yl)sulfonyl-N-(1-methylpiperidin-4-yl)benzamide |
| SMILES | CN1CCC(NC(=O)c2cc(S(=O)(=O)N3CCN(C)CC3)ccc2Cl)CC1 |
| InChI | InChI=1S/C18H27ClN4O3S/c1-21-7-5-14(6-8-21)20-18(24)16-13-15(3-4-17(16)19)27(25,26)23-11-9-22(2)10-12-23/h3-4,13-14H,5-12H2,1-2H3,(H,20,24) |
| InChIKey | SXLGUQHTDDRIKL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |