C18H18Cl2N2O3S — CID 108561561
N-[1-(benzenesulfonyl)piperidin-4-yl]-2,5-dichlorobenzamide (PubChem CID 108561561) has the molecular formula C18H18Cl2N2O3S and a molecular weight of 413.33 g/mol. Its IUPAC name is N-[1-(benzenesulfonyl)piperidin-4-yl]-2,5-dichlorobenzamide.
| Compound Name | N-[1-(benzenesulfonyl)piperidin-4-yl]-2,5-dichlorobenzamide |
|---|---|
| PubChem CID | 108561561 |
| Molecular Formula | C18H18Cl2N2O3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | N-[1-(benzenesulfonyl)piperidin-4-yl]-2,5-dichlorobenzamide |
| SMILES | O=C(NC1CCN(S(=O)(=O)c2ccccc2)CC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H18Cl2N2O3S/c19-13-6-7-17(20)16(12-13)18(23)21-14-8-10-22(11-9-14)26(24,25)15-4-2-1-3-5-15/h1-7,12,14H,8-11H2,(H,21,23) |
| InChIKey | BWMPALUXSNWOFV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |