C24H24N2O4S2 — CID 100678383
4-morpholin-4-ylsulfonyl-N-[4-(phenylsulfanylmethyl)phenyl]benzamide (PubChem CID 100678383) has the molecular formula C24H24N2O4S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 4-morpholin-4-ylsulfonyl-N-[4-(phenylsulfanylmethyl)phenyl]benzamide.
| Compound Name | 4-morpholin-4-ylsulfonyl-N-[4-(phenylsulfanylmethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 100678383 |
| Molecular Formula | C24H24N2O4S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 4-morpholin-4-ylsulfonyl-N-[4-(phenylsulfanylmethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CSc2ccccc2)cc1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H24N2O4S2/c27-24(20-8-12-23(13-9-20)32(28,29)26-14-16-30-17-15-26)25-21-10-6-19(7-11-21)18-31-22-4-2-1-3-5-22/h1-13H,14-18H2,(H,25,27) |
| InChIKey | MZWFENSJJLQCKB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |