C24H31N3O4S — CID 126320858
N-[4-(azepan-1-ylsulfonyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide (PubChem CID 126320858) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 126320858 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-4-(morpholin-4-ylmethyl)benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1ccc(CN2CCOCC2)cc1 |
| InChI | InChI=1S/C24H31N3O4S/c28-24(21-7-5-20(6-8-21)19-26-15-17-31-18-16-26)25-22-9-11-23(12-10-22)32(29,30)27-13-3-1-2-4-14-27/h5-12H,1-4,13-19H2,(H,25,28) |
| InChIKey | GWTBWFCIPCMZCD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |