C18H19ClN2O3S2 — CID 112789663
N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methylsulfanylbenzamide (PubChem CID 112789663) has the molecular formula C18H19ClN2O3S2 and a molecular weight of 410.95 g/mol. Its IUPAC name is N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methylsulfanylbenzamide.
| Compound Name | N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 112789663 |
| Molecular Formula | C18H19ClN2O3S2 |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H19ClN2O3S2/c1-25-16-7-3-2-6-14(16)18(22)20-13-8-9-15(19)17(12-13)26(23,24)21-10-4-5-11-21/h2-3,6-9,12H,4-5,10-11H2,1H3,(H,20,22) |
| InChIKey | FGYHGYRIZRSXSS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |