C17H18ClN3O4S — CID 39983441
N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methoxypyridine-3-carboxamide (PubChem CID 39983441) has the molecular formula C17H18ClN3O4S and a molecular weight of 395.87 g/mol. Its IUPAC name is N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methoxypyridine-3-carboxamide.
| Compound Name | N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 39983441 |
| Molecular Formula | C17H18ClN3O4S |
| Molecular Weight | 395.87 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C17H18ClN3O4S/c1-25-17-13(5-4-8-19-17)16(22)20-12-6-7-14(18)15(11-12)26(23,24)21-9-2-3-10-21/h4-8,11H,2-3,9-10H2,1H3,(H,20,22) |
| InChIKey | OPUHIVSZFMUFSF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.87 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |