C16H23ClN2O3S2 — CID 78769070
2-tert-butylsulfanyl-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 78769070) has the molecular formula C16H23ClN2O3S2 and a molecular weight of 390.96 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-tert-butylsulfanyl-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 78769070 |
| Molecular Formula | C16H23ClN2O3S2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-tert-butylsulfanyl-N-(4-chloro-3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | CC(C)(C)SCC(=O)Nc1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C16H23ClN2O3S2/c1-16(2,3)23-11-15(20)18-12-6-7-13(17)14(10-12)24(21,22)19-8-4-5-9-19/h6-7,10H,4-5,8-9,11H2,1-3H3,(H,18,20) |
| InChIKey | AFDGBMDDCUGMIG-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |