C24H26N2O4S2 — CID 60621795
3-(phenylsulfanylmethyl)-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]furan-2-carboxamide (PubChem CID 60621795) has the molecular formula C24H26N2O4S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 3-(phenylsulfanylmethyl)-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]furan-2-carboxamide.
| Compound Name | 3-(phenylsulfanylmethyl)-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60621795 |
| Molecular Formula | C24H26N2O4S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 3-(phenylsulfanylmethyl)-N-[(3-piperidin-1-ylsulfonylphenyl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1cccc(S(=O)(=O)N2CCCCC2)c1)c1occc1CSc1ccccc1 |
| InChI | InChI=1S/C24H26N2O4S2/c27-24(23-20(12-15-30-23)18-31-21-9-3-1-4-10-21)25-17-19-8-7-11-22(16-19)32(28,29)26-13-5-2-6-14-26/h1,3-4,7-12,15-16H,2,5-6,13-14,17-18H2,(H,25,27) |
| InChIKey | RBFWOFJUUOAZMA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |