C21H18F3N3O4S — CID 55712137
3-(benzylsulfamoyl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide (PubChem CID 55712137) has the molecular formula C21H18F3N3O4S and a molecular weight of 465.45 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide.
| Compound Name | 3-(benzylsulfamoyl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 55712137 |
| Molecular Formula | C21H18F3N3O4S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 3-(benzylsulfamoyl)-N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(OCC(F)(F)F)nc1)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C21H18F3N3O4S/c22-21(23,24)14-31-19-10-9-17(13-25-19)27-20(28)16-7-4-8-18(11-16)32(29,30)26-12-15-5-2-1-3-6-15/h1-11,13,26H,12,14H2,(H,27,28) |
| InChIKey | VEFYWKLCDSIIQG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |