C23H21F3N2O4S — CID 55712150
3-(benzylsulfamoyl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide (PubChem CID 55712150) has the molecular formula C23H21F3N2O4S and a molecular weight of 478.49 g/mol. Its IUPAC name is 3-(benzylsulfamoyl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide.
| Compound Name | 3-(benzylsulfamoyl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55712150 |
| Molecular Formula | C23H21F3N2O4S |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 3-(benzylsulfamoyl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(OCC(F)(F)F)c1)c1cccc(S(=O)(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H21F3N2O4S/c24-23(25,26)16-32-20-10-4-8-18(12-20)14-27-22(29)19-9-5-11-21(13-19)33(30,31)28-15-17-6-2-1-3-7-17/h1-13,28H,14-16H2,(H,27,29) |
| InChIKey | IEGRNCYUJUCHGS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |