C19H19F3N2O4S — CID 55712157
3-(prop-2-enylsulfamoyl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide (PubChem CID 55712157) has the molecular formula C19H19F3N2O4S and a molecular weight of 428.43 g/mol. Its IUPAC name is 3-(prop-2-enylsulfamoyl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide.
| Compound Name | 3-(prop-2-enylsulfamoyl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55712157 |
| Molecular Formula | C19H19F3N2O4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 3-(prop-2-enylsulfamoyl)-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)NCc2cccc(OCC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C19H19F3N2O4S/c1-2-9-24-29(26,27)17-8-4-6-15(11-17)18(25)23-12-14-5-3-7-16(10-14)28-13-19(20,21)22/h2-8,10-11,24H,1,9,12-13H2,(H,23,25) |
| InChIKey | RMJYLFXDJHPWEG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|