C18H16ClF3N2O4S — CID 86949018
3-[[4-chloro-2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]-N-prop-2-enylbenzamide (PubChem CID 86949018) has the molecular formula C18H16ClF3N2O4S and a molecular weight of 448.85 g/mol. Its IUPAC name is 3-[[4-chloro-2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]-N-prop-2-enylbenzamide.
| Compound Name | 3-[[4-chloro-2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 86949018 |
| Molecular Formula | C18H16ClF3N2O4S |
| Molecular Weight | 448.85 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 3-[[4-chloro-2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(S(=O)(=O)Nc2ccc(Cl)cc2OCC(F)(F)F)c1 |
| InChI | InChI=1S/C18H16ClF3N2O4S/c1-2-8-23-17(25)12-4-3-5-14(9-12)29(26,27)24-15-7-6-13(19)10-16(15)28-11-18(20,21)22/h2-7,9-10,24H,1,8,11H2,(H,23,25) |
| InChIKey | HQBGPHBPFPZSGM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.85 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|