C16H13F3N2O3S — CID 109062412
3-(prop-2-enylsulfamoyl)-N-(2,3,4-trifluorophenyl)benzamide (PubChem CID 109062412) has the molecular formula C16H13F3N2O3S and a molecular weight of 370.35 g/mol. Its IUPAC name is 3-(prop-2-enylsulfamoyl)-N-(2,3,4-trifluorophenyl)benzamide.
| Compound Name | 3-(prop-2-enylsulfamoyl)-N-(2,3,4-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 109062412 |
| Molecular Formula | C16H13F3N2O3S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 3-(prop-2-enylsulfamoyl)-N-(2,3,4-trifluorophenyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C16H13F3N2O3S/c1-2-8-20-25(23,24)11-5-3-4-10(9-11)16(22)21-13-7-6-12(17)14(18)15(13)19/h2-7,9,20H,1,8H2,(H,21,22) |
| InChIKey | IRSDPGLHMNMSCP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|