C17H18N2O5S2 — CID 9071953
N-(3-methylsulfonylphenyl)-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 9071953) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-(3-methylsulfonylphenyl)-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-(3-methylsulfonylphenyl)-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9071953 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N-(3-methylsulfonylphenyl)-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)Nc2cccc(S(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C17H18N2O5S2/c1-3-10-18-26(23,24)16-9-4-6-13(11-16)17(20)19-14-7-5-8-15(12-14)25(2,21)22/h3-9,11-12,18H,1,10H2,2H3,(H,19,20) |
| InChIKey | JKZLYCLLQSZQEW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|