C21H25N3O4S — CID 55844311
N-[[3-(butanoylamino)phenyl]methyl]-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 55844311) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N-[[3-(butanoylamino)phenyl]methyl]-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[[3-(butanoylamino)phenyl]methyl]-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55844311 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[[3-(butanoylamino)phenyl]methyl]-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)NCc2cccc(NC(=O)CCC)c2)c1 |
| InChI | InChI=1S/C21H25N3O4S/c1-3-7-20(25)24-18-10-5-8-16(13-18)15-22-21(26)17-9-6-11-19(14-17)29(27,28)23-12-4-2/h4-6,8-11,13-14,23H,2-3,7,12,15H2,1H3,(H,22,26)(H,24,25) |
| InChIKey | VZTMSRNCEPQKAI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|