C20H22ClN3O4S — CID 55862592
N-[4-(4-chloroanilino)-4-oxobutyl]-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 55862592) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is N-[4-(4-chloroanilino)-4-oxobutyl]-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[4-(4-chloroanilino)-4-oxobutyl]-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55862592 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | N-[4-(4-chloroanilino)-4-oxobutyl]-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)NCCCC(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H22ClN3O4S/c1-2-12-23-29(27,28)18-6-3-5-15(14-18)20(26)22-13-4-7-19(25)24-17-10-8-16(21)9-11-17/h2-3,5-6,8-11,14,23H,1,4,7,12-13H2,(H,22,26)(H,24,25) |
| InChIKey | MANKJWWVEHQKOF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|