C19H22N2O3S2 — CID 38570641
N-(3-phenylsulfanylpropyl)-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 38570641) has the molecular formula C19H22N2O3S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is N-(3-phenylsulfanylpropyl)-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-(3-phenylsulfanylpropyl)-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 38570641 |
| Molecular Formula | C19H22N2O3S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | N-(3-phenylsulfanylpropyl)-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)NCCCSc2ccccc2)c1 |
| InChI | InChI=1S/C19H22N2O3S2/c1-2-12-21-26(23,24)18-11-6-8-16(15-18)19(22)20-13-7-14-25-17-9-4-3-5-10-17/h2-6,8-11,15,21H,1,7,12-14H2,(H,20,22) |
| InChIKey | ROWPDOMDELFLBZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|