C22H21FN2O3S2 — CID 27802378
3-(benzenesulfonamido)-N-[3-(4-fluorophenyl)sulfanylpropyl]benzamide (PubChem CID 27802378) has the molecular formula C22H21FN2O3S2 and a molecular weight of 444.55 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-N-[3-(4-fluorophenyl)sulfanylpropyl]benzamide.
| Compound Name | 3-(benzenesulfonamido)-N-[3-(4-fluorophenyl)sulfanylpropyl]benzamide |
|---|---|
| PubChem CID | 27802378 |
| Molecular Formula | C22H21FN2O3S2 |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 3-(benzenesulfonamido)-N-[3-(4-fluorophenyl)sulfanylpropyl]benzamide |
| SMILES | O=C(NCCCSc1ccc(F)cc1)c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C22H21FN2O3S2/c23-18-10-12-20(13-11-18)29-15-5-14-24-22(26)17-6-4-7-19(16-17)25-30(27,28)21-8-2-1-3-9-21/h1-4,6-13,16,25H,5,14-15H2,(H,24,26) |
| InChIKey | RHBUAWUZEUUCBB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|