C23H22N2O5S2 — CID 24549461
3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2-phenylsulfanylethyl)benzamide (PubChem CID 24549461) has the molecular formula C23H22N2O5S2 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2-phenylsulfanylethyl)benzamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2-phenylsulfanylethyl)benzamide |
|---|---|
| PubChem CID | 24549461 |
| Molecular Formula | C23H22N2O5S2 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2-phenylsulfanylethyl)benzamide |
| SMILES | O=C(NCCSc1ccccc1)c1cccc(NS(=O)(=O)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C23H22N2O5S2/c26-23(24-11-14-31-19-7-2-1-3-8-19)17-5-4-6-18(15-17)25-32(27,28)20-9-10-21-22(16-20)30-13-12-29-21/h1-10,15-16,25H,11-14H2,(H,24,26) |
| InChIKey | MXQNPTQIXRLOIE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|