C21H19N3O7S2 — CID 4844447
3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(3-sulfamoylphenyl)benzamide (PubChem CID 4844447) has the molecular formula C21H19N3O7S2 and a molecular weight of 489.53 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(3-sulfamoylphenyl)benzamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(3-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 4844447 |
| Molecular Formula | C21H19N3O7S2 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(3-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2cccc(NS(=O)(=O)c3ccc4c(c3)OCCO4)c2)c1 |
| InChI | InChI=1S/C21H19N3O7S2/c22-32(26,27)17-6-2-4-15(12-17)23-21(25)14-3-1-5-16(11-14)24-33(28,29)18-7-8-19-20(13-18)31-10-9-30-19/h1-8,11-13,24H,9-10H2,(H,23,25)(H2,22,26,27) |
| InChIKey | KOVWAUFHBNEOIL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 153.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |