C21H17FN2O5S — CID 29291056
3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(3-fluorophenyl)benzamide (PubChem CID 29291056) has the molecular formula C21H17FN2O5S and a molecular weight of 428.44 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(3-fluorophenyl)benzamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 29291056 |
| Molecular Formula | C21H17FN2O5S |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(3-fluorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(F)c1)c1cccc(NS(=O)(=O)c2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C21H17FN2O5S/c22-15-4-2-5-16(12-15)23-21(25)14-3-1-6-17(11-14)24-30(26,27)18-7-8-19-20(13-18)29-10-9-28-19/h1-8,11-13,24H,9-10H2,(H,23,25) |
| InChIKey | PYCPMDDPKPAUFV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |