C16H14ClF3N2O4S — CID 24633180
4-[[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]-N-methylbenzamide (PubChem CID 24633180) has the molecular formula C16H14ClF3N2O4S and a molecular weight of 422.81 g/mol. Its IUPAC name is 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]-N-methylbenzamide.
| Compound Name | 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 24633180 |
| Molecular Formula | C16H14ClF3N2O4S |
| Molecular Weight | 422.81 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 4-[[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(S(=O)(=O)Nc2cc(Cl)ccc2OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14ClF3N2O4S/c1-21-15(23)10-2-5-12(6-3-10)27(24,25)22-13-8-11(17)4-7-14(13)26-9-16(18,19)20/h2-8,22H,9H2,1H3,(H,21,23) |
| InChIKey | UNFBUHYNJQUEOE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |