C15H10ClF3INO2 — CID 55520956
N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-4-iodobenzamide (PubChem CID 55520956) has the molecular formula C15H10ClF3INO2 and a molecular weight of 455.60 g/mol. Its IUPAC name is N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-4-iodobenzamide.
| Compound Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 55520956 |
| Molecular Formula | C15H10ClF3INO2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 454.94 |
| IUPAC Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-4-iodobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1OCC(F)(F)F)c1ccc(I)cc1 |
| InChI | InChI=1S/C15H10ClF3INO2/c16-10-3-6-13(23-8-15(17,18)19)12(7-10)21-14(22)9-1-4-11(20)5-2-9/h1-7H,8H2,(H,21,22) |
| InChIKey | CZTCCEJCZPCVAX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|