C17H15ClF3NO4 — CID 134027238
N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,3-dimethoxybenzamide (PubChem CID 134027238) has the molecular formula C17H15ClF3NO4 and a molecular weight of 389.76 g/mol. Its IUPAC name is N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 134027238 |
| Molecular Formula | C17H15ClF3NO4 |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)Nc2cc(Cl)ccc2OCC(F)(F)F)c1OC |
| InChI | InChI=1S/C17H15ClF3NO4/c1-24-14-5-3-4-11(15(14)25-2)16(23)22-12-8-10(18)6-7-13(12)26-9-17(19,20)21/h3-8H,9H2,1-2H3,(H,22,23) |
| InChIKey | HMPBGWZQHPXDTJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |