C13H9ClF3NO3 — CID 37175499
N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]furan-3-carboxamide (PubChem CID 37175499) has the molecular formula C13H9ClF3NO3 and a molecular weight of 319.67 g/mol. Its IUPAC name is N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]furan-3-carboxamide.
| Compound Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 37175499 |
| Molecular Formula | C13H9ClF3NO3 |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1OCC(F)(F)F)c1ccoc1 |
| InChI | InChI=1S/C13H9ClF3NO3/c14-9-1-2-11(21-7-13(15,16)17)10(5-9)18-12(19)8-3-4-20-6-8/h1-6H,7H2,(H,18,19) |
| InChIKey | JWTBAUUVTWMFAP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |