C15H9ClF5NO2 — CID 134027237
N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,6-difluorobenzamide (PubChem CID 134027237) has the molecular formula C15H9ClF5NO2 and a molecular weight of 365.69 g/mol. Its IUPAC name is N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,6-difluorobenzamide.
| Compound Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 134027237 |
| Molecular Formula | C15H9ClF5NO2 |
| Molecular Weight | 365.69 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-2,6-difluorobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1OCC(F)(F)F)c1c(F)cccc1F |
| InChI | InChI=1S/C15H9ClF5NO2/c16-8-4-5-12(24-7-15(19,20)21)11(6-8)22-14(23)13-9(17)2-1-3-10(13)18/h1-6H,7H2,(H,22,23) |
| InChIKey | QTLVGCYNXGPULD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.69 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |