C17H12ClF4NO2 — CID 98674038
(E)-N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 98674038) has the molecular formula C17H12ClF4NO2 and a molecular weight of 373.73 g/mol. Its IUPAC name is (E)-N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 98674038 |
| Molecular Formula | C17H12ClF4NO2 |
| Molecular Weight | 373.73 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | (E)-N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1F)Nc1cc(Cl)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C17H12ClF4NO2/c18-12-6-7-15(25-10-17(20,21)22)14(9-12)23-16(24)8-5-11-3-1-2-4-13(11)19/h1-9H,10H2,(H,23,24)/b8-5+ |
| InChIKey | PRWXHMOSQLUCNG-VMPITWQZSA-N |
| XLogP | 5.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.73 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|