C17H11ClF3NO3 — CID 54441739
4-chloro-2-[3-[2-(trifluoromethyl)phenyl]prop-2-enoylamino]benzoic acid (PubChem CID 54441739) has the molecular formula C17H11ClF3NO3 and a molecular weight of 369.73 g/mol. Its IUPAC name is 4-chloro-2-[3-[2-(trifluoromethyl)phenyl]prop-2-enoylamino]benzoic acid.
| Compound Name | 4-chloro-2-[3-[2-(trifluoromethyl)phenyl]prop-2-enoylamino]benzoic acid |
|---|---|
| PubChem CID | 54441739 |
| Molecular Formula | C17H11ClF3NO3 |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 4-chloro-2-[3-[2-(trifluoromethyl)phenyl]prop-2-enoylamino]benzoic acid |
| SMILES | O=C(C=Cc1ccccc1C(F)(F)F)Nc1cc(Cl)ccc1C(=O)O |
| InChI | InChI=1S/C17H11ClF3NO3/c18-11-6-7-12(16(24)25)14(9-11)22-15(23)8-5-10-3-1-2-4-13(10)17(19,20)21/h1-9H,(H,22,23)(H,24,25) |
| InChIKey | WOOPYIXEJVISMW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|