C16H13NO5 — CID 73175506
4-hydroxy-2-[3-(2-hydroxyphenyl)prop-2-enoylamino]benzoic acid (PubChem CID 73175506) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 4-hydroxy-2-[3-(2-hydroxyphenyl)prop-2-enoylamino]benzoic acid.
| Compound Name | 4-hydroxy-2-[3-(2-hydroxyphenyl)prop-2-enoylamino]benzoic acid |
|---|---|
| PubChem CID | 73175506 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-hydroxy-2-[3-(2-hydroxyphenyl)prop-2-enoylamino]benzoic acid |
| SMILES | O=C(C=Cc1ccccc1O)Nc1cc(O)ccc1C(=O)O |
| InChI | InChI=1S/C16H13NO5/c18-11-6-7-12(16(21)22)13(9-11)17-15(20)8-5-10-3-1-2-4-14(10)19/h1-9,18-19H,(H,17,20)(H,21,22) |
| InChIKey | KTGAIGUHRACKNU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|