C18H15ClF3N3O4S — CID 37175902
N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-4-(2-cyanoethylsulfamoyl)benzamide (PubChem CID 37175902) has the molecular formula C18H15ClF3N3O4S and a molecular weight of 461.85 g/mol. Its IUPAC name is N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-4-(2-cyanoethylsulfamoyl)benzamide.
| Compound Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-4-(2-cyanoethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 37175902 |
| Molecular Formula | C18H15ClF3N3O4S |
| Molecular Weight | 461.85 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | N-[5-chloro-2-(2,2,2-trifluoroethoxy)phenyl]-4-(2-cyanoethylsulfamoyl)benzamide |
| SMILES | N#CCCNS(=O)(=O)c1ccc(C(=O)Nc2cc(Cl)ccc2OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H15ClF3N3O4S/c19-13-4-7-16(29-11-18(20,21)22)15(10-13)25-17(26)12-2-5-14(6-3-12)30(27,28)24-9-1-8-23/h2-7,10,24H,1,9,11H2,(H,25,26) |
| InChIKey | BADVKMRXCUOXIT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|