C17H14F3N3O3S — CID 34298929
4-(2-cyanoethylsulfamoyl)-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 34298929) has the molecular formula C17H14F3N3O3S and a molecular weight of 397.38 g/mol. Its IUPAC name is 4-(2-cyanoethylsulfamoyl)-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-(2-cyanoethylsulfamoyl)-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 34298929 |
| Molecular Formula | C17H14F3N3O3S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-(2-cyanoethylsulfamoyl)-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | N#CCCNS(=O)(=O)c1ccc(C(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H14F3N3O3S/c18-17(19,20)13-4-6-14(7-5-13)23-16(24)12-2-8-15(9-3-12)27(25,26)22-11-1-10-21/h2-9,22H,1,11H2,(H,23,24) |
| InChIKey | JMXYXRDCKUHIFK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|