C11H10F3NO2S — CID 90538003
N-but-3-ynyl-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 90538003) has the molecular formula C11H10F3NO2S and a molecular weight of 277.27 g/mol. Its IUPAC name is N-but-3-ynyl-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-but-3-ynyl-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90538003 |
| Molecular Formula | C11H10F3NO2S |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | N-but-3-ynyl-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | C#CCCNS(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3NO2S/c1-2-3-8-15-18(16,17)10-6-4-9(5-7-10)11(12,13)14/h1,4-7,15H,3,8H2 |
| InChIKey | REBKTEWSDBOPSR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|