C13H18F3N3O2S — CID 119966218
N-(2-piperazin-1-ylethyl)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 119966218) has the molecular formula C13H18F3N3O2S and a molecular weight of 337.37 g/mol. Its IUPAC name is N-(2-piperazin-1-ylethyl)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-(2-piperazin-1-ylethyl)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119966218 |
| Molecular Formula | C13H18F3N3O2S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-(2-piperazin-1-ylethyl)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCN1CCNCC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3N3O2S/c14-13(15,16)11-1-3-12(4-2-11)22(20,21)18-7-10-19-8-5-17-6-9-19/h1-4,17-18H,5-10H2 |
| InChIKey | XRNIOCMJOSKPAZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |