C14H19F4N3O2S — CID 120706378
3-fluoro-N-(3-piperazin-1-ylpropyl)-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 120706378) has the molecular formula C14H19F4N3O2S and a molecular weight of 369.38 g/mol. Its IUPAC name is 3-fluoro-N-(3-piperazin-1-ylpropyl)-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 3-fluoro-N-(3-piperazin-1-ylpropyl)-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120706378 |
| Molecular Formula | C14H19F4N3O2S |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 3-fluoro-N-(3-piperazin-1-ylpropyl)-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCN1CCNCC1)c1ccc(C(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C14H19F4N3O2S/c15-13-10-11(2-3-12(13)14(16,17)18)24(22,23)20-4-1-7-21-8-5-19-6-9-21/h2-3,10,19-20H,1,4-9H2 |
| InChIKey | UIQRWGUIRONLLK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|