C17H29Cl2N3O2S — CID 119994834
N-(3-piperazin-1-ylpropyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;dihydrochloride (PubChem CID 119994834) has the molecular formula C17H29Cl2N3O2S and a molecular weight of 410.41 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;dihydrochloride.
| Compound Name | N-(3-piperazin-1-ylpropyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 119994834 |
| Molecular Formula | C17H29Cl2N3O2S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-5,6,7,8-tetrahydronaphthalene-2-sulfonamide;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(NCCCN1CCNCC1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C17H27N3O2S.2ClH/c21-23(22,19-8-3-11-20-12-9-18-10-13-20)17-7-6-15-4-1-2-5-16(15)14-17;;/h6-7,14,18-19H,1-5,8-13H2;2*1H |
| InChIKey | FHLZYRRTTZJILR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|