C15H26Cl2N4O3S — CID 119994544
2-methyl-5-(3-piperazin-1-ylpropylsulfamoyl)benzamide;dihydrochloride (PubChem CID 119994544) has the molecular formula C15H26Cl2N4O3S and a molecular weight of 413.37 g/mol. Its IUPAC name is 2-methyl-5-(3-piperazin-1-ylpropylsulfamoyl)benzamide;dihydrochloride.
| Compound Name | 2-methyl-5-(3-piperazin-1-ylpropylsulfamoyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119994544 |
| Molecular Formula | C15H26Cl2N4O3S |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-methyl-5-(3-piperazin-1-ylpropylsulfamoyl)benzamide;dihydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)NCCCN2CCNCC2)cc1C(N)=O.Cl.Cl |
| InChI | InChI=1S/C15H24N4O3S.2ClH/c1-12-3-4-13(11-14(12)15(16)20)23(21,22)18-5-2-8-19-9-6-17-7-10-19;;/h3-4,11,17-18H,2,5-10H2,1H3,(H2,16,20);2*1H |
| InChIKey | KOUKNBABXFDHTI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|