C18H31ClN4O4S — CID 119390825
5-(2-methoxyethylsulfamoyl)-2-methyl-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride (PubChem CID 119390825) has the molecular formula C18H31ClN4O4S and a molecular weight of 434.99 g/mol. Its IUPAC name is 5-(2-methoxyethylsulfamoyl)-2-methyl-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride.
| Compound Name | 5-(2-methoxyethylsulfamoyl)-2-methyl-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119390825 |
| Molecular Formula | C18H31ClN4O4S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 5-(2-methoxyethylsulfamoyl)-2-methyl-N-(3-piperazin-1-ylpropyl)benzamide;hydrochloride |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)NCCCN2CCNCC2)c1.Cl |
| InChI | InChI=1S/C18H30N4O4S.ClH/c1-15-4-5-16(27(24,25)21-9-13-26-2)14-17(15)18(23)20-6-3-10-22-11-7-19-8-12-22;/h4-5,14,19,21H,3,6-13H2,1-2H3,(H,20,23);1H |
| InChIKey | WJMHPKWWKWIMPC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|