C19H32N4O4S — CID 55656660
4-(2-methoxyethylsulfamoyl)-N-[4-(4-methylpiperazin-1-yl)butyl]benzamide (PubChem CID 55656660) has the molecular formula C19H32N4O4S and a molecular weight of 412.56 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfamoyl)-N-[4-(4-methylpiperazin-1-yl)butyl]benzamide.
| Compound Name | 4-(2-methoxyethylsulfamoyl)-N-[4-(4-methylpiperazin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 55656660 |
| Molecular Formula | C19H32N4O4S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 4-(2-methoxyethylsulfamoyl)-N-[4-(4-methylpiperazin-1-yl)butyl]benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NCCCCN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C19H32N4O4S/c1-22-12-14-23(15-13-22)11-4-3-9-20-19(24)17-5-7-18(8-6-17)28(25,26)21-10-16-27-2/h5-8,21H,3-4,9-16H2,1-2H3,(H,20,24) |
| InChIKey | ABKBVAAFEHAKCU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|